methyl 4-nitrobenzenesulfonate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

methyl p-nitrobenzenesulfonate; methyl 4-nitrobenzenesulfonate; methyl nosylate
Links:📖 PubMed
CAS RN:[6214-20-6]
Formula:C7H7NO5S; 217.20 g/mol
InChiKey:RMNJNEUWTBBZPT-UHFFFAOYSA-N
SMILES:CO[S](=O)(=O)c1ccc(cc1)[N+]([O-])=O
Molecular structure of methyl 4-nitrobenzenesulfonate
Melting point:94 °C

Isomers

2-amino-4-sulfobenzoic acid
Molecular structure of 2-amino-4-sulfobenzoic acid
3-amino-5-sulfobenzoic acid
Molecular structure of 3-amino-5-sulfobenzoic acid
4-amino-2-sulfobenzoic acid
Molecular structure of 4-amino-2-sulfobenzoic acid
methyl 4-nitrobenzenesulfonate
Molecular structure of methyl 4-nitrobenzenesulfonate
2-methyl-5-nitrobenzenesulfonic acid
Molecular structure of 2-methyl-5-nitrobenzenesulfonic acid
  ::